C10H9NOS — CID 591743
4-(2-methyl-1,3-thiazol-4-yl)phenol (PubChem CID 591743) has the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. Its IUPAC name is 4-(2-methyl-1,3-thiazol-4-yl)phenol.
| Compound Name | 4-(2-methyl-1,3-thiazol-4-yl)phenol |
|---|---|
| PubChem CID | 591743 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 4-(2-methyl-1,3-thiazol-4-yl)phenol |
| SMILES | Cc1nc(-c2ccc(O)cc2)cs1 |
| InChI | InChI=1S/C10H9NOS/c1-7-11-10(6-13-7)8-2-4-9(12)5-3-8/h2-6,12H,1H3 |
| InChIKey | HOAYTTLLVORNLA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |