C10H6F2N2O2S — CID 116824051
5-(3,4-difluorophenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid (PubChem CID 116824051) has the molecular formula C10H6F2N2O2S and a molecular weight of 256.23 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid.
| Compound Name | 5-(3,4-difluorophenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116824051 |
| Molecular Formula | C10H6F2N2O2S |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 5-(3,4-difluorophenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid |
| SMILES | O=C(O)c1[nH]c(=S)[nH]c1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H6F2N2O2S/c11-5-2-1-4(3-6(5)12)7-8(9(15)16)14-10(17)13-7/h1-3H,(H,15,16)(H2,13,14,17) |
| InChIKey | JIIWSRBSBFCOPF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|