C8H5FN2O2S — CID 130164627
6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid (PubChem CID 130164627) has the molecular formula C8H5FN2O2S and a molecular weight of 212.20 g/mol. Its IUPAC name is 6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid.
| Compound Name | 6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 130164627 |
| Molecular Formula | C8H5FN2O2S |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc2[nH]c(=S)[nH]c2cc1F |
| InChI | InChI=1S/C8H5FN2O2S/c9-4-2-6-5(10-8(14)11-6)1-3(4)7(12)13/h1-2H,(H,12,13)(H2,10,11,14) |
| InChIKey | TZDXFJPVNVJGMN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|