C20H19FN2O2S — CID 22907628
5-[2-(4-fluorophenyl)spiro[4.4]nona-1,3-dien-3-yl]pyridine-2-sulfonamide (PubChem CID 22907628) has the molecular formula C20H19FN2O2S and a molecular weight of 370.45 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)spiro[4.4]nona-1,3-dien-3-yl]pyridine-2-sulfonamide.
| Compound Name | 5-[2-(4-fluorophenyl)spiro[4.4]nona-1,3-dien-3-yl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 22907628 |
| Molecular Formula | C20H19FN2O2S |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 5-[2-(4-fluorophenyl)spiro[4.4]nona-1,3-dien-3-yl]pyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=CC3(C=C2c2ccc(F)cc2)CCCC3)cn1 |
| InChI | InChI=1S/C20H19FN2O2S/c21-16-6-3-14(4-7-16)17-11-20(9-1-2-10-20)12-18(17)15-5-8-19(23-13-15)26(22,24)25/h3-8,11-13H,1-2,9-10H2,(H2,22,24,25) |
| InChIKey | JOCVTVRZHKJQMO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |