C20H20N2O2S — CID 22907574
4-(3-pyridin-4-ylspiro[4.4]nona-1,3-dien-2-yl)benzenesulfonamide (PubChem CID 22907574) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 4-(3-pyridin-4-ylspiro[4.4]nona-1,3-dien-2-yl)benzenesulfonamide.
| Compound Name | 4-(3-pyridin-4-ylspiro[4.4]nona-1,3-dien-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22907574 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 4-(3-pyridin-4-ylspiro[4.4]nona-1,3-dien-2-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=CC3(C=C2c2ccncc2)CCCC3)cc1 |
| InChI | InChI=1S/C20H20N2O2S/c21-25(23,24)17-5-3-15(4-6-17)18-13-20(9-1-2-10-20)14-19(18)16-7-11-22-12-8-16/h3-8,11-14H,1-2,9-10H2,(H2,21,23,24) |
| InChIKey | BLRSQKFZYAHSKK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |