C20H19NO2S2 — CID 22907352
4-[6-(4-sulfanylphenyl)spiro[3.4]octa-5,7-dien-7-yl]benzenesulfonamide (PubChem CID 22907352) has the molecular formula C20H19NO2S2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-[6-(4-sulfanylphenyl)spiro[3.4]octa-5,7-dien-7-yl]benzenesulfonamide.
| Compound Name | 4-[6-(4-sulfanylphenyl)spiro[3.4]octa-5,7-dien-7-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22907352 |
| Molecular Formula | C20H19NO2S2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 4-[6-(4-sulfanylphenyl)spiro[3.4]octa-5,7-dien-7-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=CC3(C=C2c2ccc(S)cc2)CCC3)cc1 |
| InChI | InChI=1S/C20H19NO2S2/c21-25(22,23)17-8-4-15(5-9-17)19-13-20(10-1-11-20)12-18(19)14-2-6-16(24)7-3-14/h2-9,12-13,24H,1,10-11H2,(H2,21,22,23) |
| InChIKey | YQRJEUYURNWVGV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|