C19H17ClN2O2S — CID 22907647
4-[7-(6-chloro-3-pyridinyl)spiro[3.4]octa-5,7-dien-6-yl]benzenesulfonamide (PubChem CID 22907647) has the molecular formula C19H17ClN2O2S and a molecular weight of 372.88 g/mol. Its IUPAC name is 4-[7-(6-chloro-3-pyridinyl)spiro[3.4]octa-5,7-dien-6-yl]benzenesulfonamide.
| Compound Name | 4-[7-(6-chloro-3-pyridinyl)spiro[3.4]octa-5,7-dien-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22907647 |
| Molecular Formula | C19H17ClN2O2S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 4-[7-(6-chloro-3-pyridinyl)spiro[3.4]octa-5,7-dien-6-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=CC3(C=C2c2ccc(Cl)nc2)CCC3)cc1 |
| InChI | InChI=1S/C19H17ClN2O2S/c20-18-7-4-14(12-22-18)17-11-19(8-1-9-19)10-16(17)13-2-5-15(6-3-13)25(21,23)24/h2-7,10-12H,1,8-9H2,(H2,21,23,24) |
| InChIKey | QWLOJFIIUBPGTM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|