About cyclohexene;1-methylsulfonyl-4-phenylbenzene
cyclohexene;1-methylsulfonyl-4-phenylbenzene (PubChem CID 68567759) has the molecular formula C19H22O2S
and a molecular weight of 314.45 g/mol. Its IUPAC name is cyclohexene;1-methylsulfonyl-4-phenylbenzene.
Molecular Properties
| Compound Name | cyclohexene;1-methylsulfonyl-4-phenylbenzene |
| PubChem CID | 68567759 |
| Molecular Formula | C19H22O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | cyclohexene;1-methylsulfonyl-4-phenylbenzene |
| SMILES | C1=CCCCC1.CS(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O2S.C6H10/c1-16(14,15)13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-2-4-6-5-3-1/h2-10H,1H3;1-2H,3-6H2 |
| InChIKey | VKRJHPHUZGWTSV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohexene;1-methylsulfonyl-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexene;1-methylsulfonyl-4-phenylbenzene?
The IUPAC name of cyclohexene;1-methylsulfonyl-4-phenylbenzene (CID 68567759) is cyclohexene;1-methylsulfonyl-4-phenylbenzene.
What is the SMILES notation for cyclohexene;1-methylsulfonyl-4-phenylbenzene?
The canonical SMILES for cyclohexene;1-methylsulfonyl-4-phenylbenzene is C1=CCCCC1.CS(=O)(=O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of cyclohexene;1-methylsulfonyl-4-phenylbenzene?
The InChIKey is VKRJHPHUZGWTSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2S.C6H10/c1-16(14,15)13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-2-4-6-5-3-1/h2-10H,1H3;1-2H,3-6H2.
What are the key properties of cyclohexene;1-methylsulfonyl-4-phenylbenzene?
cyclohexene;1-methylsulfonyl-4-phenylbenzene has a molecular weight of 314.45 g/mol, XLogP of 4.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexene;1-methylsulfonyl-4-phenylbenzene is sourced from PubChem (CID 68567759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).