C30H26O4S2 — CID 158321253
1,3-bis[4-(4-methylsulfonylphenyl)cyclopenta-1,3-dien-1-yl]benzene (PubChem CID 158321253) has the molecular formula C30H26O4S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is 1,3-bis[4-(4-methylsulfonylphenyl)cyclopenta-1,3-dien-1-yl]benzene.
| Compound Name | 1,3-bis[4-(4-methylsulfonylphenyl)cyclopenta-1,3-dien-1-yl]benzene |
|---|---|
| PubChem CID | 158321253 |
| Molecular Formula | C30H26O4S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 1,3-bis[4-(4-methylsulfonylphenyl)cyclopenta-1,3-dien-1-yl]benzene |
| SMILES | CS(=O)(=O)c1ccc(C2=CC=C(c3cccc(C4=CC=C(c5ccc(S(C)(=O)=O)cc5)C4)c3)C2)cc1 |
| InChI | InChI=1S/C30H26O4S2/c1-35(31,32)29-14-10-21(11-15-29)25-6-8-27(19-25)23-4-3-5-24(18-23)28-9-7-26(20-28)22-12-16-30(17-13-22)36(2,33)34/h3-18H,19-20H2,1-2H3 |
| InChIKey | SMKPEGMRPZWEGS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |