C12H16NO2PS — CID 145237067
[4-(3-methylsulfonylphenyl)-3,6-dihydro-2H-pyridin-1-yl]phosphane (PubChem CID 145237067) has the molecular formula C12H16NO2PS and a molecular weight of 269.31 g/mol. Its IUPAC name is [4-(3-methylsulfonylphenyl)-3,6-dihydro-2H-pyridin-1-yl]phosphane.
| Compound Name | [4-(3-methylsulfonylphenyl)-3,6-dihydro-2H-pyridin-1-yl]phosphane |
|---|---|
| PubChem CID | 145237067 |
| Molecular Formula | C12H16NO2PS |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | [4-(3-methylsulfonylphenyl)-3,6-dihydro-2H-pyridin-1-yl]phosphane |
| SMILES | CS(=O)(=O)c1cccc(C2=CCN(P)CC2)c1 |
| InChI | InChI=1S/C12H16NO2PS/c1-17(14,15)12-4-2-3-11(9-12)10-5-7-13(16)8-6-10/h2-5,9H,6-8,16H2,1H3 |
| InChIKey | FXVUIAAPMJIRAQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|