C14H23N2OP3 — CID 145203670
N,N-bis(phosphanyl)-4-(1-phosphanyl-3,6-dihydro-2H-pyridin-4-yl)-2-propan-2-yloxyaniline (PubChem CID 145203670) has the molecular formula C14H23N2OP3 and a molecular weight of 328.27 g/mol. Its IUPAC name is N,N-bis(phosphanyl)-4-(1-phosphanyl-3,6-dihydro-2H-pyridin-4-yl)-2-propan-2-yloxyaniline.
| Compound Name | N,N-bis(phosphanyl)-4-(1-phosphanyl-3,6-dihydro-2H-pyridin-4-yl)-2-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 145203670 |
| Molecular Formula | C14H23N2OP3 |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N,N-bis(phosphanyl)-4-(1-phosphanyl-3,6-dihydro-2H-pyridin-4-yl)-2-propan-2-yloxyaniline |
| SMILES | CC(C)Oc1cc(C2=CCN(P)CC2)ccc1N(P)P |
| InChI | InChI=1S/C14H23N2OP3/c1-10(2)17-14-9-12(3-4-13(14)16(19)20)11-5-7-15(18)8-6-11/h3-5,9-10H,6-8,18-20H2,1-2H3 |
| InChIKey | ASEDDNYJGFKSMP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|