C12H13ClFNO — CID 118221082
1-chloro-4-(3-fluoro-4-methoxyphenyl)-3,6-dihydro-2H-pyridine (PubChem CID 118221082) has the molecular formula C12H13ClFNO and a molecular weight of 241.69 g/mol. Its IUPAC name is 1-chloro-4-(3-fluoro-4-methoxyphenyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-chloro-4-(3-fluoro-4-methoxyphenyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 118221082 |
| Molecular Formula | C12H13ClFNO |
| Molecular Weight | 241.69 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-chloro-4-(3-fluoro-4-methoxyphenyl)-3,6-dihydro-2H-pyridine |
| SMILES | COc1ccc(C2=CCN(Cl)CC2)cc1F |
| InChI | InChI=1S/C12H13ClFNO/c1-16-12-3-2-10(8-11(12)14)9-4-6-15(13)7-5-9/h2-4,8H,5-7H2,1H3 |
| InChIKey | UTJQPFHCHPUOLF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.69 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|