C13H16O2 — CID 71373642
4-(cyclopenten-1-yl)-1,2-dimethoxybenzene (PubChem CID 71373642) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-(cyclopenten-1-yl)-1,2-dimethoxybenzene.
| Compound Name | 4-(cyclopenten-1-yl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 71373642 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 4-(cyclopenten-1-yl)-1,2-dimethoxybenzene |
| SMILES | COc1ccc(C2=CCCC2)cc1OC |
| InChI | InChI=1S/C13H16O2/c1-14-12-8-7-11(9-13(12)15-2)10-5-3-4-6-10/h5,7-9H,3-4,6H2,1-2H3 |
| InChIKey | YZWDXGZNKVQTDG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |