C21H22N2O2 — CID 174194024
7-(cyclohexen-1-yl)-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine (PubChem CID 174194024) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 7-(cyclohexen-1-yl)-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine.
| Compound Name | 7-(cyclohexen-1-yl)-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 174194024 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 7-(cyclohexen-1-yl)-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine |
| SMILES | COc1ccc(-c2cn3ccc(C4=CCCCC4)cc3n2)cc1OC |
| InChI | InChI=1S/C21H22N2O2/c1-24-19-9-8-17(12-20(19)25-2)18-14-23-11-10-16(13-21(23)22-18)15-6-4-3-5-7-15/h6,8-14H,3-5,7H2,1-2H3 |
| InChIKey | QLFHZLGMBGGOES-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |