C20H21ClN3O5P — CID 135334864
[4-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]-3,6-dihydro-2H-pyridin-1-yl]phosphonic acid (PubChem CID 135334864) has the molecular formula C20H21ClN3O5P and a molecular weight of 449.83 g/mol. Its IUPAC name is [4-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]-3,6-dihydro-2H-pyridin-1-yl]phosphonic acid.
| Compound Name | [4-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]-3,6-dihydro-2H-pyridin-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 135334864 |
| Molecular Formula | C20H21ClN3O5P |
| Molecular Weight | 449.83 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | [4-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]-3,6-dihydro-2H-pyridin-1-yl]phosphonic acid |
| SMILES | COc1cc(OC)c(-c2cn3ccc(C4=CCN(P(=O)(O)O)CC4)cc3n2)cc1Cl |
| InChI | InChI=1S/C20H21ClN3O5P/c1-28-18-11-19(29-2)16(21)10-15(18)17-12-23-6-3-14(9-20(23)22-17)13-4-7-24(8-5-13)30(25,26)27/h3-4,6,9-12H,5,7-8H2,1-2H3,(H2,25,26,27) |
| InChIKey | LNJBSYMEWGYMPA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.83 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|