C18H20N4O3 — CID 86342380
4-[2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-7-yl]morpholine (PubChem CID 86342380) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-7-yl]morpholine.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-7-yl]morpholine |
|---|---|
| PubChem CID | 86342380 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-7-yl]morpholine |
| SMILES | COc1ccc(-c2cn3ccc(N4CCOCC4)nc3n2)cc1OC |
| InChI | InChI=1S/C18H20N4O3/c1-23-15-4-3-13(11-16(15)24-2)14-12-22-6-5-17(20-18(22)19-14)21-7-9-25-10-8-21/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | OXLCRXCXDSZGFG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 61.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |