C19H22ClN5O2 — CID 42632845
4-[6-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]pyridazin-3-yl]morpholine;hydrochloride (PubChem CID 42632845) has the molecular formula C19H22ClN5O2 and a molecular weight of 387.87 g/mol. Its IUPAC name is 4-[6-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]pyridazin-3-yl]morpholine;hydrochloride.
| Compound Name | 4-[6-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]pyridazin-3-yl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 42632845 |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-[6-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]pyridazin-3-yl]morpholine;hydrochloride |
| SMILES | COc1cc(-c2ccc(N3CCOCC3)nn2)ccc1-n1cnc(C)c1.Cl |
| InChI | InChI=1S/C19H21N5O2.ClH/c1-14-12-24(13-20-14)17-5-3-15(11-18(17)25-2)16-4-6-19(22-21-16)23-7-9-26-10-8-23;/h3-6,11-13H,7-10H2,1-2H3;1H |
| InChIKey | BZHUTOLDXRSBMN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |