C25H25N5O2 — CID 42632668
4-[6-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]pyridazin-3-yl]-3-phenylmorpholine (PubChem CID 42632668) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 4-[6-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]pyridazin-3-yl]-3-phenylmorpholine.
| Compound Name | 4-[6-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]pyridazin-3-yl]-3-phenylmorpholine |
|---|---|
| PubChem CID | 42632668 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 4-[6-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]pyridazin-3-yl]-3-phenylmorpholine |
| SMILES | COc1cc(-c2ccc(N3CCOCC3c3ccccc3)nn2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H25N5O2/c1-18-15-29(17-26-18)22-10-8-20(14-24(22)31-2)21-9-11-25(28-27-21)30-12-13-32-16-23(30)19-6-4-3-5-7-19/h3-11,14-15,17,23H,12-13,16H2,1-2H3 |
| InChIKey | ZAVWPKAWBVYAPS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |