C25H26N6O2 — CID 59472614
1-benzyl-3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]piperidin-2-one (PubChem CID 59472614) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-benzyl-3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]piperidin-2-one.
| Compound Name | 1-benzyl-3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]piperidin-2-one |
|---|---|
| PubChem CID | 59472614 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 1-benzyl-3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]piperidin-2-one |
| SMILES | COc1cc(-c2cn(C3CCCN(Cc4ccccc4)C3=O)nn2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H26N6O2/c1-18-14-30(17-26-18)22-11-10-20(13-24(22)33-2)21-16-31(28-27-21)23-9-6-12-29(25(23)32)15-19-7-4-3-5-8-19/h3-5,7-8,10-11,13-14,16-17,23H,6,9,12,15H2,1-2H3 |
| InChIKey | RNXRMKNNMWKZIX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |