C25H28N6O — CID 59472541
3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-5-phenylazepane (PubChem CID 59472541) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is 3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-5-phenylazepane.
| Compound Name | 3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-5-phenylazepane |
|---|---|
| PubChem CID | 59472541 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-5-phenylazepane |
| SMILES | COc1cc(-c2cn(C3CNCCC(c4ccccc4)C3)nn2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H28N6O/c1-18-15-30(17-27-18)24-9-8-21(13-25(24)32-2)23-16-31(29-28-23)22-12-20(10-11-26-14-22)19-6-4-3-5-7-19/h3-9,13,15-17,20,22,26H,10-12,14H2,1-2H3 |
| InChIKey | GPSAJAXRBVKCNB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |