C24H28N6O — CID 70273786
3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-1-methyl-2,3,4,5,5a,9a-hexahydro-1-benzazepine (PubChem CID 70273786) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is 3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-1-methyl-2,3,4,5,5a,9a-hexahydro-1-benzazepine.
| Compound Name | 3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-1-methyl-2,3,4,5,5a,9a-hexahydro-1-benzazepine |
|---|---|
| PubChem CID | 70273786 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-1-methyl-2,3,4,5,5a,9a-hexahydro-1-benzazepine |
| SMILES | COc1cc(-c2cn(C3CCC4C=CC=CC4N(C)C3)nn2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H28N6O/c1-17-13-29(16-25-17)23-11-9-19(12-24(23)31-3)21-15-30(27-26-21)20-10-8-18-6-4-5-7-22(18)28(2)14-20/h4-7,9,11-13,15-16,18,20,22H,8,10,14H2,1-3H3 |
| InChIKey | BPETUFFYFRVWPC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |