C23H19N7O2 — CID 59472479
4-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-3-phenyl-1H-pyridazin-6-one (PubChem CID 59472479) has the molecular formula C23H19N7O2 and a molecular weight of 425.45 g/mol. Its IUPAC name is 4-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-3-phenyl-1H-pyridazin-6-one.
| Compound Name | 4-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-3-phenyl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 59472479 |
| Molecular Formula | C23H19N7O2 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 4-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-3-phenyl-1H-pyridazin-6-one |
| SMILES | COc1cc(-c2cn(-c3cc(=O)[nH]nc3-c3ccccc3)nn2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C23H19N7O2/c1-15-12-29(14-24-15)19-9-8-17(10-21(19)32-2)18-13-30(28-25-18)20-11-22(31)26-27-23(20)16-6-4-3-5-7-16/h3-14H,1-2H3,(H,26,31) |
| InChIKey | GBNFPYWEKAVDCG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |