C24H22N6O — CID 59472774
4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-1-[(4-pyrrol-1-ylphenyl)methyl]triazole (PubChem CID 59472774) has the molecular formula C24H22N6O and a molecular weight of 410.48 g/mol. Its IUPAC name is 4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-1-[(4-pyrrol-1-ylphenyl)methyl]triazole.
| Compound Name | 4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-1-[(4-pyrrol-1-ylphenyl)methyl]triazole |
|---|---|
| PubChem CID | 59472774 |
| Molecular Formula | C24H22N6O |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-1-[(4-pyrrol-1-ylphenyl)methyl]triazole |
| SMILES | COc1cc(-c2cn(Cc3ccc(-n4cccc4)cc3)nn2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H22N6O/c1-18-14-29(17-25-18)23-10-7-20(13-24(23)31-2)22-16-30(27-26-22)15-19-5-8-21(9-6-19)28-11-3-4-12-28/h3-14,16-17H,15H2,1-2H3 |
| InChIKey | MZTFKSPPMPPDJE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 62.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |