C17H18N4O2 — CID 86342378
4-[2-(3-methoxyphenyl)imidazo[1,2-a]pyrimidin-7-yl]morpholine (PubChem CID 86342378) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 4-[2-(3-methoxyphenyl)imidazo[1,2-a]pyrimidin-7-yl]morpholine.
| Compound Name | 4-[2-(3-methoxyphenyl)imidazo[1,2-a]pyrimidin-7-yl]morpholine |
|---|---|
| PubChem CID | 86342378 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-[2-(3-methoxyphenyl)imidazo[1,2-a]pyrimidin-7-yl]morpholine |
| SMILES | COc1cccc(-c2cn3ccc(N4CCOCC4)nc3n2)c1 |
| InChI | InChI=1S/C17H18N4O2/c1-22-14-4-2-3-13(11-14)15-12-21-6-5-16(19-17(21)18-15)20-7-9-23-10-8-20/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | PCRGLJHFYILWPC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |