C14H14ClFN4 — CID 122596102
1-chloro-4-[3-fluoro-4-(1-methyl-1,2,4-triazol-3-yl)phenyl]-3,6-dihydro-2H-pyridine (PubChem CID 122596102) has the molecular formula C14H14ClFN4 and a molecular weight of 292.75 g/mol. Its IUPAC name is 1-chloro-4-[3-fluoro-4-(1-methyl-1,2,4-triazol-3-yl)phenyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-chloro-4-[3-fluoro-4-(1-methyl-1,2,4-triazol-3-yl)phenyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 122596102 |
| Molecular Formula | C14H14ClFN4 |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-chloro-4-[3-fluoro-4-(1-methyl-1,2,4-triazol-3-yl)phenyl]-3,6-dihydro-2H-pyridine |
| SMILES | Cn1cnc(-c2ccc(C3=CCN(Cl)CC3)cc2F)n1 |
| InChI | InChI=1S/C14H14ClFN4/c1-19-9-17-14(18-19)12-3-2-11(8-13(12)16)10-4-6-20(15)7-5-10/h2-4,8-9H,5-7H2,1H3 |
| InChIKey | UBSSHPQYDLINKM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|