C17H24Cl3N3O — CID 174974543
5-(aminomethyl)-2-propan-2-yloxy-4-[1-(2,2,2-trichloroethyl)-3,6-dihydro-2H-pyridin-4-yl]aniline (PubChem CID 174974543) has the molecular formula C17H24Cl3N3O and a molecular weight of 392.76 g/mol. Its IUPAC name is 5-(aminomethyl)-2-propan-2-yloxy-4-[1-(2,2,2-trichloroethyl)-3,6-dihydro-2H-pyridin-4-yl]aniline.
| Compound Name | 5-(aminomethyl)-2-propan-2-yloxy-4-[1-(2,2,2-trichloroethyl)-3,6-dihydro-2H-pyridin-4-yl]aniline |
|---|---|
| PubChem CID | 174974543 |
| Molecular Formula | C17H24Cl3N3O |
| Molecular Weight | 392.76 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 5-(aminomethyl)-2-propan-2-yloxy-4-[1-(2,2,2-trichloroethyl)-3,6-dihydro-2H-pyridin-4-yl]aniline |
| SMILES | CC(C)Oc1cc(C2=CCN(CC(Cl)(Cl)Cl)CC2)c(CN)cc1N |
| InChI | InChI=1S/C17H24Cl3N3O/c1-11(2)24-16-8-14(13(9-21)7-15(16)22)12-3-5-23(6-4-12)10-17(18,19)20/h3,7-8,11H,4-6,9-10,21-22H2,1-2H3 |
| InChIKey | RJBYBXMYKAONDV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.76 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|