C20H30F2N2O3 — CID 118549860
tert-butyl 4-[4-amino-5-(1,3-difluoropropan-2-yloxy)-2-methylphenyl]piperidine-1-carboxylate (PubChem CID 118549860) has the molecular formula C20H30F2N2O3 and a molecular weight of 384.47 g/mol. Its IUPAC name is tert-butyl 4-[4-amino-5-(1,3-difluoropropan-2-yloxy)-2-methylphenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-amino-5-(1,3-difluoropropan-2-yloxy)-2-methylphenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118549860 |
| Molecular Formula | C20H30F2N2O3 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | tert-butyl 4-[4-amino-5-(1,3-difluoropropan-2-yloxy)-2-methylphenyl]piperidine-1-carboxylate |
| SMILES | Cc1cc(N)c(OC(CF)CF)cc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H30F2N2O3/c1-13-9-17(23)18(26-15(11-21)12-22)10-16(13)14-5-7-24(8-6-14)19(25)27-20(2,3)4/h9-10,14-15H,5-8,11-12,23H2,1-4H3 |
| InChIKey | RERNRPHVRADUSU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|