C12H15NO2S — CID 22397844
4-(3-methylsulfonylphenyl)-1,2,3,6-tetrahydropyridine (PubChem CID 22397844) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 4-(3-methylsulfonylphenyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(3-methylsulfonylphenyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 22397844 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 4-(3-methylsulfonylphenyl)-1,2,3,6-tetrahydropyridine |
| SMILES | CS(=O)(=O)c1cccc(C2=CCNCC2)c1 |
| InChI | InChI=1S/C12H15NO2S/c1-16(14,15)12-4-2-3-11(9-12)10-5-7-13-8-6-10/h2-5,9,13H,6-8H2,1H3 |
| InChIKey | JTQJRJLDKOSNJF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |