C18H15F3O2S — CID 22917374
1,3,5-trifluoro-2-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene (PubChem CID 22917374) has the molecular formula C18H15F3O2S and a molecular weight of 352.38 g/mol. Its IUPAC name is 1,3,5-trifluoro-2-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene.
| Compound Name | 1,3,5-trifluoro-2-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene |
|---|---|
| PubChem CID | 22917374 |
| Molecular Formula | C18H15F3O2S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 1,3,5-trifluoro-2-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3c(F)cc(F)cc3F)CCC2)cc1 |
| InChI | InChI=1S/C18H15F3O2S/c1-24(22,23)13-7-5-11(6-8-13)14-3-2-4-15(14)18-16(20)9-12(19)10-17(18)21/h5-10H,2-4H2,1H3 |
| InChIKey | AIBNFMGTZLUYIX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|