C21H24ClFO2S — CID 142190480
(1Z)-1-(5-chloro-4-fluorocyclohexa-1,3-dien-1-yl)-2-(4-methylsulfonylphenyl)cyclooctene (PubChem CID 142190480) has the molecular formula C21H24ClFO2S and a molecular weight of 394.94 g/mol. Its IUPAC name is (1Z)-1-(5-chloro-4-fluorocyclohexa-1,3-dien-1-yl)-2-(4-methylsulfonylphenyl)cyclooctene.
| Compound Name | (1Z)-1-(5-chloro-4-fluorocyclohexa-1,3-dien-1-yl)-2-(4-methylsulfonylphenyl)cyclooctene |
|---|---|
| PubChem CID | 142190480 |
| Molecular Formula | C21H24ClFO2S |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (1Z)-1-(5-chloro-4-fluorocyclohexa-1,3-dien-1-yl)-2-(4-methylsulfonylphenyl)cyclooctene |
| SMILES | CS(=O)(=O)c1ccc(/C2=C(\C3=CC=C(F)C(Cl)C3)CCCCCC2)cc1 |
| InChI | InChI=1S/C21H24ClFO2S/c1-26(24,25)17-11-8-15(9-12-17)18-6-4-2-3-5-7-19(18)16-10-13-21(23)20(22)14-16/h8-13,20H,2-7,14H2,1H3/b19-18- |
| InChIKey | OJOYOPJIXBZEMM-HNENSFHCSA-N |
| XLogP | 5.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|