C21H18O6 — CID 632599
methyl 2-[3-methoxy-4-(4-methoxyphenyl)-5-oxofuran-2-ylidene]-2-phenylacetate (PubChem CID 632599) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is methyl 2-[3-methoxy-4-(4-methoxyphenyl)-5-oxofuran-2-ylidene]-2-phenylacetate.
| Compound Name | methyl 2-[3-methoxy-4-(4-methoxyphenyl)-5-oxofuran-2-ylidene]-2-phenylacetate |
|---|---|
| PubChem CID | 632599 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | methyl 2-[3-methoxy-4-(4-methoxyphenyl)-5-oxofuran-2-ylidene]-2-phenylacetate |
| SMILES | COC(=O)C(=C1OC(=O)C(c2ccc(OC)cc2)=C1OC)c1ccccc1 |
| InChI | InChI=1S/C21H18O6/c1-24-15-11-9-14(10-12-15)16-18(25-2)19(27-21(16)23)17(20(22)26-3)13-7-5-4-6-8-13/h4-12H,1-3H3 |
| InChIKey | CLOXWXMRGIFQET-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|