C22H18O7 — CID 54732404
methyl (2E)-2-(4-acetylphenyl)-2-[3-hydroxy-4-(4-methoxyphenyl)-5-oxofuran-2-ylidene]acetate (PubChem CID 54732404) has the molecular formula C22H18O7 and a molecular weight of 394.38 g/mol. Its IUPAC name is methyl (2E)-2-(4-acetylphenyl)-2-[3-hydroxy-4-(4-methoxyphenyl)-5-oxofuran-2-ylidene]acetate.
| Compound Name | methyl (2E)-2-(4-acetylphenyl)-2-[3-hydroxy-4-(4-methoxyphenyl)-5-oxofuran-2-ylidene]acetate |
|---|---|
| PubChem CID | 54732404 |
| Molecular Formula | C22H18O7 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | methyl (2E)-2-(4-acetylphenyl)-2-[3-hydroxy-4-(4-methoxyphenyl)-5-oxofuran-2-ylidene]acetate |
| SMILES | COC(=O)/C(=C1/OC(=O)C(c2ccc(OC)cc2)=C1O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C22H18O7/c1-12(23)13-4-6-15(7-5-13)18(21(25)28-3)20-19(24)17(22(26)29-20)14-8-10-16(27-2)11-9-14/h4-11,24H,1-3H3/b20-18+ |
| InChIKey | OQEKHMRMVQTMKW-CZIZESTLSA-N |
| XLogP | 3.31 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|