C16H17NO6 — CID 54737471
(2E)-2-[3-hydroxy-4-(4-methoxyphenyl)-5-oxofuran-2-ylidene]-N-methoxy-N-methylpropanamide (PubChem CID 54737471) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is (2E)-2-[3-hydroxy-4-(4-methoxyphenyl)-5-oxofuran-2-ylidene]-N-methoxy-N-methylpropanamide.
| Compound Name | (2E)-2-[3-hydroxy-4-(4-methoxyphenyl)-5-oxofuran-2-ylidene]-N-methoxy-N-methylpropanamide |
|---|---|
| PubChem CID | 54737471 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (2E)-2-[3-hydroxy-4-(4-methoxyphenyl)-5-oxofuran-2-ylidene]-N-methoxy-N-methylpropanamide |
| SMILES | COc1ccc(C2=C(O)/C(=C(/C)C(=O)N(C)OC)OC2=O)cc1 |
| InChI | InChI=1S/C16H17NO6/c1-9(15(19)17(2)22-4)14-13(18)12(16(20)23-14)10-5-7-11(21-3)8-6-10/h5-8,18H,1-4H3/b14-9+ |
| InChIKey | UFICSZMOJPBZTH-NTEUORMPSA-N |
| XLogP | 1.81 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|