C12H10O5 — CID 583985
3-hydroxy-4-(4-methoxyphenyl)pyran-2,5-dione (PubChem CID 583985) has the molecular formula C12H10O5 and a molecular weight of 234.21 g/mol. Its IUPAC name is 3-hydroxy-4-(4-methoxyphenyl)pyran-2,5-dione.
| Compound Name | 3-hydroxy-4-(4-methoxyphenyl)pyran-2,5-dione |
|---|---|
| PubChem CID | 583985 |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 3-hydroxy-4-(4-methoxyphenyl)pyran-2,5-dione |
| SMILES | COc1ccc(C2=C(O)C(=O)OCC2=O)cc1 |
| InChI | InChI=1S/C12H10O5/c1-16-8-4-2-7(3-5-8)10-9(13)6-17-12(15)11(10)14/h2-5,14H,6H2,1H3 |
| InChIKey | IYJKYBJIEWHVJL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |