C19H14O4 — CID 14057718
4-hydroxy-9-(4-methoxyphenyl)-3H-benzo[f][2]benzofuran-1-one (PubChem CID 14057718) has the molecular formula C19H14O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-hydroxy-9-(4-methoxyphenyl)-3H-benzo[f][2]benzofuran-1-one.
| Compound Name | 4-hydroxy-9-(4-methoxyphenyl)-3H-benzo[f][2]benzofuran-1-one |
|---|---|
| PubChem CID | 14057718 |
| Molecular Formula | C19H14O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-hydroxy-9-(4-methoxyphenyl)-3H-benzo[f][2]benzofuran-1-one |
| SMILES | COc1ccc(-c2c3c(c(O)c4ccccc24)COC3=O)cc1 |
| InChI | InChI=1S/C19H14O4/c1-22-12-8-6-11(7-9-12)16-13-4-2-3-5-14(13)18(20)15-10-23-19(21)17(15)16/h2-9,20H,10H2,1H3 |
| InChIKey | VVVORIQYPOBQQS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |