C29H25NO6 — CID 5376312
methyl 2-[[(2E)-2-(3-methoxy-5-oxo-4-phenylfuran-2-ylidene)-2-phenylacetyl]amino]-3-phenylpropanoate (PubChem CID 5376312) has the molecular formula C29H25NO6 and a molecular weight of 483.52 g/mol. Its IUPAC name is methyl 2-[[(2E)-2-(3-methoxy-5-oxo-4-phenylfuran-2-ylidene)-2-phenylacetyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[(2E)-2-(3-methoxy-5-oxo-4-phenylfuran-2-ylidene)-2-phenylacetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 5376312 |
| Molecular Formula | C29H25NO6 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | methyl 2-[[(2E)-2-(3-methoxy-5-oxo-4-phenylfuran-2-ylidene)-2-phenylacetyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)/C(=C1/OC(=O)C(c2ccccc2)=C1OC)c1ccccc1 |
| InChI | InChI=1S/C29H25NO6/c1-34-25-24(21-16-10-5-11-17-21)29(33)36-26(25)23(20-14-8-4-9-15-20)27(31)30-22(28(32)35-2)18-19-12-6-3-7-13-19/h3-17,22H,18H2,1-2H3,(H,30,31)/b26-23+ |
| InChIKey | NYYLBTMLYPSROK-WNAAXNPUSA-N |
| XLogP | 3.91 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|