C16H9BrO2 — CID 15195207
3-bromo-2-phenylazulene-1,5-dione (PubChem CID 15195207) has the molecular formula C16H9BrO2 and a molecular weight of 313.15 g/mol. Its IUPAC name is 3-bromo-2-phenylazulene-1,5-dione.
| Compound Name | 3-bromo-2-phenylazulene-1,5-dione |
|---|---|
| PubChem CID | 15195207 |
| Molecular Formula | C16H9BrO2 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 3-bromo-2-phenylazulene-1,5-dione |
| SMILES | O=C1C(c2ccccc2)=C(Br)c2cc(=O)cccc21 |
| InChI | InChI=1S/C16H9BrO2/c17-15-13-9-11(18)7-4-8-12(13)16(19)14(15)10-5-2-1-3-6-10/h1-9H |
| InChIKey | AOYHOIPFSJLUEC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |