About 3-bromoazulene-1,5-dione
3-bromoazulene-1,5-dione (PubChem CID 10900648) has the molecular formula C10H5BrO2
and a molecular weight of 237.05 g/mol. Its IUPAC name is 3-bromoazulene-1,5-dione.
Molecular Properties
| Compound Name | 3-bromoazulene-1,5-dione |
| PubChem CID | 10900648 |
| Molecular Formula | C10H5BrO2 |
| Molecular Weight | 237.05 g/mol |
| Exact Mass | 235.95 |
| IUPAC Name | 3-bromoazulene-1,5-dione |
| SMILES | O=C1C=C(Br)c2cc(=O)cccc21 |
| InChI | InChI=1S/C10H5BrO2/c11-9-5-10(13)7-3-1-2-6(12)4-8(7)9/h1-5H |
| InChIKey | LYIZNUKBFOYXPK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.05 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromoazulene-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromoazulene-1,5-dione?
The IUPAC name of 3-bromoazulene-1,5-dione (CID 10900648) is 3-bromoazulene-1,5-dione.
What is the SMILES notation for 3-bromoazulene-1,5-dione?
The canonical SMILES for 3-bromoazulene-1,5-dione is O=C1C=C(Br)c2cc(=O)cccc21.
What is the InChIKey of 3-bromoazulene-1,5-dione?
The InChIKey is LYIZNUKBFOYXPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrO2/c11-9-5-10(13)7-3-1-2-6(12)4-8(7)9/h1-5H.
What are the key properties of 3-bromoazulene-1,5-dione?
3-bromoazulene-1,5-dione has a molecular weight of 237.05 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromoazulene-1,5-dione is sourced from PubChem (CID 10900648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).