C13H12O2 — CID 15109160
4,6,8-trimethylazulene-1,5-dione (PubChem CID 15109160) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 4,6,8-trimethylazulene-1,5-dione.
| Compound Name | 4,6,8-trimethylazulene-1,5-dione |
|---|---|
| PubChem CID | 15109160 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 4,6,8-trimethylazulene-1,5-dione |
| SMILES | Cc1cc(C)c(=O)c(C)c2c1C(=O)C=C2 |
| InChI | InChI=1S/C13H12O2/c1-7-6-8(2)13(15)9(3)10-4-5-11(14)12(7)10/h4-6H,1-3H3 |
| InChIKey | VJOLEETXZCRVOS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |