C10H6O4 — CID 15647394
4-methylchromene-2,7,8-trione (PubChem CID 15647394) has the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. Its IUPAC name is 4-methylchromene-2,7,8-trione.
| Compound Name | 4-methylchromene-2,7,8-trione |
|---|---|
| PubChem CID | 15647394 |
| Molecular Formula | C10H6O4 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 4-methylchromene-2,7,8-trione |
| SMILES | Cc1cc(=O)oc2c1C=CC(=O)C2=O |
| InChI | InChI=1S/C10H6O4/c1-5-4-8(12)14-10-6(5)2-3-7(11)9(10)13/h2-4H,1H3 |
| InChIKey | UNIVBNNWEDTHKT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|