C12H6O3 — CID 91617324
azuleno[8,7-b]furan-2,9-dione (PubChem CID 91617324) has the molecular formula C12H6O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is azuleno[8,7-b]furan-2,9-dione.
| Compound Name | azuleno[8,7-b]furan-2,9-dione |
|---|---|
| PubChem CID | 91617324 |
| Molecular Formula | C12H6O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | azuleno[8,7-b]furan-2,9-dione |
| SMILES | O=C1C=Cc2cccc3cc(=O)oc-3c21 |
| InChI | InChI=1S/C12H6O3/c13-9-5-4-7-2-1-3-8-6-10(14)15-12(8)11(7)9/h1-6H |
| InChIKey | RFPVBMLXNYQWES-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |