About 7-trimethylsilylfuro[2,3-c]pyran-2-one
7-trimethylsilylfuro[2,3-c]pyran-2-one (PubChem CID 24879420) has the molecular formula C10H12O3Si
and a molecular weight of 208.29 g/mol. Its IUPAC name is 7-trimethylsilylfuro[2,3-c]pyran-2-one.
Molecular Properties
| Compound Name | 7-trimethylsilylfuro[2,3-c]pyran-2-one |
| PubChem CID | 24879420 |
| Molecular Formula | C10H12O3Si |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 7-trimethylsilylfuro[2,3-c]pyran-2-one |
| SMILES | C[Si](C)(C)c1occc2cc(=O)oc1-2 |
| InChI | InChI=1S/C10H12O3Si/c1-14(2,3)10-9-7(4-5-12-10)6-8(11)13-9/h4-6H,1-3H3 |
| InChIKey | QKXIQQJKTPPJCF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 7-trimethylsilylfuro[2,3-c]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-trimethylsilylfuro[2,3-c]pyran-2-one?
The IUPAC name of 7-trimethylsilylfuro[2,3-c]pyran-2-one (CID 24879420) is 7-trimethylsilylfuro[2,3-c]pyran-2-one.
What is the SMILES notation for 7-trimethylsilylfuro[2,3-c]pyran-2-one?
The canonical SMILES for 7-trimethylsilylfuro[2,3-c]pyran-2-one is C[Si](C)(C)c1occc2cc(=O)oc1-2.
What is the InChIKey of 7-trimethylsilylfuro[2,3-c]pyran-2-one?
The InChIKey is QKXIQQJKTPPJCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3Si/c1-14(2,3)10-9-7(4-5-12-10)6-8(11)13-9/h4-6H,1-3H3.
What are the key properties of 7-trimethylsilylfuro[2,3-c]pyran-2-one?
7-trimethylsilylfuro[2,3-c]pyran-2-one has a molecular weight of 208.29 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-trimethylsilylfuro[2,3-c]pyran-2-one is sourced from PubChem (CID 24879420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).