C10H11BrO3Si — CID 24879421
3-bromo-7-trimethylsilylfuro[2,3-c]pyran-2-one (PubChem CID 24879421) has the molecular formula C10H11BrO3Si and a molecular weight of 287.19 g/mol. Its IUPAC name is 3-bromo-7-trimethylsilylfuro[2,3-c]pyran-2-one.
| Compound Name | 3-bromo-7-trimethylsilylfuro[2,3-c]pyran-2-one |
|---|---|
| PubChem CID | 24879421 |
| Molecular Formula | C10H11BrO3Si |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 3-bromo-7-trimethylsilylfuro[2,3-c]pyran-2-one |
| SMILES | C[Si](C)(C)c1occc2c(Br)c(=O)oc1-2 |
| InChI | InChI=1S/C10H11BrO3Si/c1-15(2,3)10-8-6(4-5-13-10)7(11)9(12)14-8/h4-5H,1-3H3 |
| InChIKey | HELCKFFYYLAOGH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|