C6H5NO3S — CID 166042446
1-methyl-1-oxofuro[3,2-d][1,2]thiazol-3-one (PubChem CID 166042446) has the molecular formula C6H5NO3S and a molecular weight of 171.18 g/mol. Its IUPAC name is 1-methyl-1-oxofuro[3,2-d][1,2]thiazol-3-one.
| Compound Name | 1-methyl-1-oxofuro[3,2-d][1,2]thiazol-3-one |
|---|---|
| PubChem CID | 166042446 |
| Molecular Formula | C6H5NO3S |
| Molecular Weight | 171.18 g/mol |
| Exact Mass | 171.00 |
| IUPAC Name | 1-methyl-1-oxofuro[3,2-d][1,2]thiazol-3-one |
| SMILES | CS1(=O)=NC(=O)c2ccoc21 |
| InChI | InChI=1S/C6H5NO3S/c1-11(9)6-4(2-3-10-6)5(8)7-11/h2-3H,1H3 |
| InChIKey | YUMCZCMYKMWJFC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 59.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |