C26H16Cl2O2 — CID 156903205
3,4-bis(3-chlorophenyl)-7-methylazuleno[2,1-c]pyran-1-one (PubChem CID 156903205) has the molecular formula C26H16Cl2O2 and a molecular weight of 431.32 g/mol. Its IUPAC name is 3,4-bis(3-chlorophenyl)-7-methylazuleno[2,1-c]pyran-1-one.
| Compound Name | 3,4-bis(3-chlorophenyl)-7-methylazuleno[2,1-c]pyran-1-one |
|---|---|
| PubChem CID | 156903205 |
| Molecular Formula | C26H16Cl2O2 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 3,4-bis(3-chlorophenyl)-7-methylazuleno[2,1-c]pyran-1-one |
| SMILES | Cc1ccc2cc3c(=O)oc(-c4cccc(Cl)c4)c(-c4cccc(Cl)c4)c3c-2cc1 |
| InChI | InChI=1S/C26H16Cl2O2/c1-15-8-10-16-14-22-24(21(16)11-9-15)23(17-4-2-6-19(27)12-17)25(30-26(22)29)18-5-3-7-20(28)13-18/h2-14H,1H3 |
| InChIKey | OMUQLITZVHBOTI-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |