C26H17Cl2NO2 — CID 165369283
3,4-bis(3-chlorophenyl)-2-methoxyazuleno[1,2-c]pyridin-1-one (PubChem CID 165369283) has the molecular formula C26H17Cl2NO2 and a molecular weight of 446.33 g/mol. Its IUPAC name is 3,4-bis(3-chlorophenyl)-2-methoxyazuleno[1,2-c]pyridin-1-one.
| Compound Name | 3,4-bis(3-chlorophenyl)-2-methoxyazuleno[1,2-c]pyridin-1-one |
|---|---|
| PubChem CID | 165369283 |
| Molecular Formula | C26H17Cl2NO2 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 3,4-bis(3-chlorophenyl)-2-methoxyazuleno[1,2-c]pyridin-1-one |
| SMILES | COn1c(-c2cccc(Cl)c2)c(-c2cccc(Cl)c2)c2cc3cccccc-3c2c1=O |
| InChI | InChI=1S/C26H17Cl2NO2/c1-31-29-25(18-9-6-11-20(28)14-18)23(17-8-5-10-19(27)13-17)22-15-16-7-3-2-4-12-21(16)24(22)26(29)30/h2-15H,1H3 |
| InChIKey | ZIOSLHCRVSLIGJ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |