C26H24O2 — CID 15109157
4,6,8-trimethyl-2-(4,6,8-trimethylazulen-1-yl)azulene-1,7-dione (PubChem CID 15109157) has the molecular formula C26H24O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 4,6,8-trimethyl-2-(4,6,8-trimethylazulen-1-yl)azulene-1,7-dione.
| Compound Name | 4,6,8-trimethyl-2-(4,6,8-trimethylazulen-1-yl)azulene-1,7-dione |
|---|---|
| PubChem CID | 15109157 |
| Molecular Formula | C26H24O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 4,6,8-trimethyl-2-(4,6,8-trimethylazulen-1-yl)azulene-1,7-dione |
| SMILES | Cc1cc(C)c2ccc(C3=Cc4c(C)cc(C)c(=O)c(C)c4C3=O)c-2c(C)c1 |
| InChI | InChI=1S/C26H24O2/c1-13-9-14(2)19-7-8-20(23(19)16(4)10-13)22-12-21-15(3)11-17(5)25(27)18(6)24(21)26(22)28/h7-12H,1-6H3 |
| InChIKey | YADARTPHCYCXQD-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |