C10H12OS — CID 14340697
3,5,7-trimethyl-2-sulfanylcyclohepta-2,4,6-trien-1-one (PubChem CID 14340697) has the molecular formula C10H12OS and a molecular weight of 180.27 g/mol. Its IUPAC name is 3,5,7-trimethyl-2-sulfanylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 3,5,7-trimethyl-2-sulfanylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 14340697 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 3,5,7-trimethyl-2-sulfanylcyclohepta-2,4,6-trien-1-one |
| SMILES | Cc1cc(C)c(S)c(=O)c(C)c1 |
| InChI | InChI=1S/C10H12OS/c1-6-4-7(2)9(11)10(12)8(3)5-6/h4-5H,1-3H3,(H,11,12) |
| InChIKey | GFKMNCXVAZTVRY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|