About potassium 3,5-dimethylbenzenethiol
potassium 3,5-dimethylbenzenethiol (PubChem CID 19605466) has the molecular formula C8H10KS+
and a molecular weight of 177.33 g/mol. Its IUPAC name is potassium 3,5-dimethylbenzenethiol.
Molecular Properties
| Compound Name | potassium 3,5-dimethylbenzenethiol |
| PubChem CID | 19605466 |
| Molecular Formula | C8H10KS+ |
| Molecular Weight | 177.33 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | potassium 3,5-dimethylbenzenethiol |
| SMILES | Cc1cc(C)cc(S)c1.[K+] |
| InChI | InChI=1S/C8H10S.K/c1-6-3-7(2)5-8(9)4-6;/h3-5,9H,1-2H3;/q;+1 |
| InChIKey | UQNYUMAPPWIOBW-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.33 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze potassium 3,5-dimethylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3,5-dimethylbenzenethiol?
The IUPAC name of potassium 3,5-dimethylbenzenethiol (CID 19605466) is potassium 3,5-dimethylbenzenethiol.
What is the SMILES notation for potassium 3,5-dimethylbenzenethiol?
The canonical SMILES for potassium 3,5-dimethylbenzenethiol is Cc1cc(C)cc(S)c1.[K+].
What is the InChIKey of potassium 3,5-dimethylbenzenethiol?
The InChIKey is UQNYUMAPPWIOBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S.K/c1-6-3-7(2)5-8(9)4-6;/h3-5,9H,1-2H3;/q;+1.
What are the key properties of potassium 3,5-dimethylbenzenethiol?
potassium 3,5-dimethylbenzenethiol has a molecular weight of 177.33 g/mol, XLogP of -0.40, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3,5-dimethylbenzenethiol is sourced from PubChem (CID 19605466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).