C10H4Br2O2 — CID 10860026
3,5-dibromoazulene-1,7-dione (PubChem CID 10860026) has the molecular formula C10H4Br2O2 and a molecular weight of 315.95 g/mol. Its IUPAC name is 3,5-dibromoazulene-1,7-dione.
| Compound Name | 3,5-dibromoazulene-1,7-dione |
|---|---|
| PubChem CID | 10860026 |
| Molecular Formula | C10H4Br2O2 |
| Molecular Weight | 315.95 g/mol |
| Exact Mass | 313.86 |
| IUPAC Name | 3,5-dibromoazulene-1,7-dione |
| SMILES | O=C1C=C(Br)c2cc(Br)cc(=O)cc21 |
| InChI | InChI=1S/C10H4Br2O2/c11-5-1-6(13)3-8-7(2-5)9(12)4-10(8)14/h1-4H |
| InChIKey | AOYQDYDMRQFOLE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.95 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |